![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| _vti_cnf/ | 2005-09-08 19:36 | - | |
| Work-Related Injurie..> | 2001-09-09 23:20 | 4.0K | |
| Work-Related Injurie..> | 2001-09-09 23:19 | 2.0K | |
| Work-Related Injurie..> | 2001-09-09 23:19 | 3.9K | |
| Work-Related Injurie..> | 2001-09-09 23:19 | 2.0K | |
| Work-Related Injurie..> | 2001-09-09 23:19 | 3.9K | |
| Work-Related Injurie..> | 2001-09-09 23:19 | 2.0K | |
| Vacation Allowances ..> | 2001-09-09 23:19 | 3.6K | |
| Universal Precaution..> | 2001-09-09 23:19 | 10K | |
| Universal Precaution..> | 2001-09-09 23:19 | 2.7K | |
| Universal Precaution..> | 2001-09-09 23:19 | 10K | |
| Universal Precaution..> | 2001-09-09 23:19 | 2.7K | |
| Universal Precaution..> | 2001-09-09 23:19 | 10K | |
| Universal Precaution..> | 2001-09-09 23:19 | 2.7K | |
| Unauthorized Release..> | 2001-09-09 23:19 | 3.2K | |
| Unauthorized Release..> | 2001-09-09 23:19 | 3.6K | |
| Unauthorized Release..> | 2001-09-09 23:19 | 3.2K | |
| Unauthorized Release..> | 2001-09-09 23:19 | 3.6K | |
| Unauthorized Release..> | 2001-09-09 23:19 | 3.2K | |
| Unauthorized Release..> | 2001-09-09 23:19 | 3.6K | |
| Tutoring2.htm | 2001-09-09 23:19 | 1.9K | |
| Tutoring.htm | 2001-09-09 23:19 | 1.8K | |
| Transfers3.htm | 2001-09-09 23:19 | 2.1K | |
| Transfers.htm | 2001-09-09 23:19 | 1.1K | |
| Termination Agreemen..> | 2001-09-09 23:19 | 3.0K | |
| Termination Agreemen..> | 2001-09-09 23:19 | 2.9K | |
| Termination Agreemen..> | 2001-09-09 23:19 | 2.9K | |
| Temporary Modified-L..> | 2001-09-09 23:19 | 3.1K | |
| Temporary Modified-L..> | 2001-09-09 23:19 | 3.0K | |
| Temporary Modified-L..> | 2001-09-09 23:19 | 3.0K | |
| Temporary Modified-L..> | 2001-09-09 23:19 | 2.0K | |
| Temporary Modified-L..> | 2001-09-09 23:19 | 2.0K | |
| Temporary Modified-L..> | 2001-09-09 23:19 | 2.0K | |
| Temporary And Part-T..> | 2001-09-09 23:19 | 4.7K | |
| Temporary-Substitute..> | 2001-09-09 23:19 | 13K | |
| Teacher Aides-Parapr..> | 2001-09-09 23:19 | 3.1K | |
| Suspension-Disciplin..> | 2001-09-09 23:19 | 4.4K | |
| Suspension-Disciplin..> | 2001-09-09 23:19 | 3.8K | |
| Substitute Teachers.htm | 2001-09-09 23:19 | 3.0K | |
| Staff Teaching Stude..> | 2001-09-09 23:19 | 5.5K | |
| Staff Teaching Stude..> | 2001-09-09 23:19 | 5.5K | |
| Staff Evaluating Tea..> | 2001-09-09 23:19 | 3.1K | |
| Staff Development5.htm | 2001-09-09 23:19 | 3.0K | |
| Staff Development4.htm | 2001-09-09 23:19 | 2.2K | |
| Staff Development3.htm | 2001-09-09 23:19 | 3.8K | |
| Staff Development2.htm | 2001-09-09 23:19 | 5.8K | |
| Staff Development.htm | 2001-09-09 23:19 | 8.2K | |
| Special Education St..> | 2001-09-09 23:19 | 2.8K | |
| Soliciting And Selli..> | 2001-09-09 23:19 | 2.4K | |
| Soliciting And Selli..> | 2001-09-09 23:19 | 2.3K | |
| Soliciting And Selli..> | 2001-09-09 23:19 | 2.3K | |
| Shared Teaching Assi..> | 2001-09-09 23:19 | 3.8K | |
| Shared Teaching Assi..> | 2001-09-09 23:18 | 1.6K | |
| Sexual Harassment6.htm | 2001-09-09 23:18 | 4.7K | |
| Sexual Harassment5.htm | 2001-09-09 23:18 | 5.6K | |
| Sexual Harassment4.htm | 2001-09-09 23:18 | 4.7K | |
| Sexual Harassment3.htm | 2001-09-09 23:18 | 5.5K | |
| Sexual Harassment2.htm | 2001-09-09 23:18 | 4.7K | |
| Sexual Harassment.htm | 2001-09-09 23:18 | 5.5K | |
| Salary Checks And De..> | 2001-09-09 23:18 | 2.4K | |
| Salary Checks And De..> | 2001-09-09 23:18 | 2.4K | |
| Salary Checks And De..> | 2001-09-09 23:18 | 2.4K | |
| Resignation3.htm | 2001-09-09 23:18 | 2.3K | |
| Resignation2.htm | 2001-09-09 23:18 | 1.9K | |
| Resignation.htm | 2001-09-09 23:18 | 2.2K | |
| Recruitment And Sele..> | 2001-09-09 23:18 | 3.4K | |
| Recruitment And Sele..> | 2001-09-09 23:18 | 2.5K | |
| Recruitment And Sele..> | 2001-09-09 23:18 | 4.4K | |
| Reasonable Accommoda..> | 2001-09-09 23:18 | 11K | |
| Publication Or Creat..> | 2001-09-09 23:18 | 2.8K | |
| Publication Or Creat..> | 2001-09-09 23:18 | 2.8K | |
| Publication Or Creat..> | 2001-09-09 23:18 | 2.8K | |
| Public Notice - Pers..> | 2001-09-09 23:18 | 4.3K | |
| Public Notice - Pers..> | 2001-09-09 23:18 | 2.5K | |
| Public Notice - Pers..> | 2001-09-09 23:18 | 4.3K | |
| Public Notice - Pers..> | 2001-09-09 23:18 | 2.5K | |
| Promotion-Demotion-R..> | 2001-09-09 23:18 | 5.2K | |
| Promotion-Demotion-R..> | 2001-09-09 23:18 | 2.2K | |
| Professional Leaves2..> | 2001-09-09 23:18 | 3.8K | |
| Professional Leaves.htm | 2001-09-09 23:18 | 3.5K | |
| Professional Leave6.htm | 2001-09-09 23:18 | 6.7K | |
| Professional Leave5.htm | 2001-09-09 23:18 | 1.5K | |
| Professional Growth2..> | 2001-09-09 23:18 | 1.7K | |
| Professional Growth.htm | 2001-09-09 23:18 | 2.8K | |
| Professional Develop..> | 2001-09-09 23:18 | 12K | |
| Professional Develop..> | 2001-09-09 23:18 | 2.9K | |
| Professional Develop..> | 2001-09-09 23:18 | 12K | |
| Professional Develop..> | 2001-09-09 23:18 | 2.9K | |
| Professional Develop..> | 2001-09-09 23:18 | 12K | |
| Professional Develop..> | 2001-09-09 23:18 | 2.9K | |
| Probationary-Permane..> | 2001-09-09 23:18 | 2.3K | |
| Probationary-Permane..> | 2001-09-09 23:18 | 2.0K | |
| Probationary-Permane..> | 2001-09-09 23:18 | 2.8K | |
| Political Leave.htm | 2001-09-09 23:18 | 2.1K | |
| Political Activities..> | 2001-09-09 23:18 | 4.0K | |
| Political Activities..> | 2001-09-09 23:18 | 2.4K | |
| Political Activities..> | 2001-09-09 23:18 | 4.0K | |
| Political Activities..> | 2001-09-09 23:18 | 2.4K | |
| Political Activities..> | 2001-09-09 23:18 | 4.0K | |
| Political Activities..> | 2001-09-09 23:18 | 2.4K | |
| Personnel Reduction4..> | 2001-09-09 23:18 | 4.8K | |
| Personnel Reduction2..> | 2001-09-09 23:18 | 3.7K | |
| Personnel Reduction.htm | 2001-09-09 23:18 | 3.0K | |
| Personnel Records2.htm | 2001-09-09 23:18 | 1.7K | |
| Personnel Records.htm | 2001-09-09 23:18 | 1.7K | |
| Personnel Files4.htm | 2001-09-09 23:17 | 1.7K | |
| Personnel Files3.htm | 2001-09-09 23:17 | 1.7K | |
| Personnel Files2.htm | 2001-09-09 23:17 | 1.7K | |
| Personnel Files.htm | 2001-09-09 23:17 | 1.7K | |
| Personal Leaves6.htm | 2001-09-09 23:17 | 5.9K | |
| Personal Leaves5.htm | 2001-09-09 23:17 | 2.4K | |
| Personal Leaves2.htm | 2001-09-09 23:17 | 5.8K | |
| Personal Leaves.htm | 2001-09-09 23:17 | 5.8K | |
| Personal Illness And..> | 2001-09-09 23:17 | 3.5K | |
| Personal Illness-Inj..> | 2001-09-09 23:17 | 3.3K | |
| Personal Illness-Inj..> | 2001-09-09 23:17 | 8.6K | |
| Personal Illness-Inj..> | 2001-09-09 23:17 | 3.3K | |
| Peer Assistance And ..> | 2001-09-09 23:17 | 15K | |
| Peer Assistance And ..> | 2001-09-09 23:17 | 4.7K | |
| Peer Assistance And ..> | 2001-09-09 23:17 | 3.1K | |
| Overtime Pay-Compens..> | 2001-09-09 23:17 | 3.7K | |
| Oath Or Affirmation6..> | 2001-09-09 23:17 | 1.7K | |
| Oath Or Affirmation5..> | 2001-09-09 23:17 | 2.3K | |
| Oath Or Affirmation4..> | 2001-09-09 23:17 | 1.6K | |
| Oath Or Affirmation3..> | 2001-09-09 23:17 | 2.3K | |
| Oath Or Affirmation2..> | 2001-09-09 23:17 | 1.6K | |
| Oath Or Affirmation.htm | 2001-09-09 23:17 | 2.3K | |
| Nonschool Employment..> | 2001-09-09 23:17 | 3.4K | |
| Nonschool Employment..> | 2001-09-09 23:17 | 3.4K | |
| Nonschool Employment..> | 2001-09-09 23:17 | 3.4K | |
| Nondiscrimination In..> | 2001-09-09 23:17 | 2.5K | |
| Nondiscrimination In..> | 2001-09-09 23:17 | 5.4K | |
| Negotiations-Consult..> | 2001-09-09 23:17 | 4.9K | |
| Negotiations-Consult..> | 2001-09-09 23:17 | 4.9K | |
| Military Leave3.htm | 2001-09-09 23:17 | 4.2K | |
| Military Leave2.htm | 2001-09-09 23:17 | 4.1K | |
| Military Leave.htm | 2001-09-09 23:17 | 4.1K | |
| Maternity-Adoptive-C..> | 2001-09-09 23:17 | 5.4K | |
| Management, Supervis..> | 2001-09-09 23:17 | 2.6K | |
| Management, Supervis..> | 2001-09-09 23:17 | 2.2K | |
| Maintenance Of Crimi..> | 2001-09-09 23:17 | 2.4K | |
| Maintenance Of Crimi..> | 2001-09-09 23:17 | 6.1K | |
| Maintenance Of Crimi..> | 2001-09-09 23:17 | 2.4K | |
| Maintenance Of Crimi..> | 2001-09-09 23:17 | 6.1K | |
| Maintenance Of Crimi..> | 2001-09-09 23:17 | 2.4K | |
| Maintenance Of Crimi..> | 2001-09-09 23:17 | 6.1K | |
| Load-Scheduling-Hour..> | 2001-09-09 23:16 | 3.4K | |
| Legal Status Require..> | 2001-09-09 23:16 | 6.4K | |
| Legal Status Require..> | 2001-09-09 23:16 | 1.9K | |
| Legal Status Require..> | 2001-09-09 23:16 | 1.8K | |
| Legal Status Require..> | 2001-09-09 23:16 | 6.4K | |
| Legal Status Require..> | 2001-09-09 23:16 | 1.8K | |
| Leaves5.htm | 2001-09-09 23:16 | 1.9K | |
| Leaves4.htm | 2001-09-09 23:16 | 2.9K | |
| Leaves3.htm | 2001-09-09 23:16 | 4.2K | |
| Leaves2.htm | 2001-09-09 23:16 | 2.9K | |
| Leaves.htm | 2001-09-09 23:16 | 4.2K | |
| Layoff-Rehire2.htm | 2001-09-09 23:16 | 10K | |
| Layoff-Rehire.htm | 2001-09-09 23:16 | 3.6K | |
| Industrial Accident-..> | 2001-09-09 23:16 | 3.6K | |
| Industrial Accident-..> | 2001-09-09 23:16 | 5.3K | |
| Industrial Accident-..> | 2001-09-09 23:16 | 3.6K | |
| Industrial Accident-..> | 2001-09-09 23:16 | 3.6K | |
| Health Examinations6..> | 2001-09-09 23:16 | 3.4K | |
| Health Examinations5..> | 2001-09-09 23:16 | 2.5K | |
| Health Examinations4..> | 2001-09-09 23:16 | 3.4K | |
| Health Examinations3..> | 2001-09-09 23:16 | 2.5K | |
| Health Examinations2..> | 2001-09-09 23:16 | 3.4K | |
| Health Examinations.htm | 2001-09-09 23:16 | 2.5K | |
| Health And Welfare B..> | 2001-09-09 23:16 | 5.3K | |
| Health And Welfare B..> | 2001-09-09 23:16 | 3.7K | |
| Health And Welfare B..> | 2001-09-09 23:16 | 5.3K | |
| Health And Welfare B..> | 2001-09-09 23:16 | 3.6K | |
| Health And Welfare B..> | 2001-09-09 23:16 | 5.3K | |
| Health And Welfare B..> | 2001-09-09 23:16 | 3.7K | |
| Gifts To Employees6.htm | 2001-09-09 23:16 | 2.5K | |
| Gifts To Employees5.htm | 2001-09-09 23:16 | 3.1K | |
| Gifts To Employees4.htm | 2001-09-09 23:16 | 2.5K | |
| Gifts To Employees3.htm | 2001-09-09 23:16 | 3.1K | |
| Gifts To Employees2.htm | 2001-09-09 23:16 | 2.5K | |
| Gifts To Employees.htm | 2001-09-09 23:16 | 3.1K | |
| Family Care And Medi..> | 2001-09-09 23:16 | 7.2K | |
| Family Care And Medi..> | 2001-09-09 23:16 | 18K | |
| Family Care And Medi..> | 2001-09-09 23:16 | 7.2K | |
| Family Care And Medi..> | 2001-09-09 23:16 | 18K | |
| Family Care And Medi..> | 2001-09-09 23:16 | 7.2K | |
| Family Care And Medi..> | 2001-09-09 23:16 | 18K | |
| Exposure Control Pla..> | 2001-09-09 23:15 | 1.9K | |
| Exposure Control Pla..> | 2001-09-09 23:15 | 14K | |
| Exposure Control Pla..> | 2001-09-09 23:15 | 3.4K | |
| Exposure Control Pla..> | 2001-09-09 23:15 | 1.8K | |
| Exposure Control Pla..> | 2001-09-09 23:15 | 14K | |
| Exposure Control Pla..> | 2001-09-09 23:15 | 3.3K | |
| Exposure Control Pla..> | 2001-09-09 23:15 | 1.8K | |
| Exposure Control Pla..> | 2001-09-09 23:15 | 14K | |
| Exposure Control Pla..> | 2001-09-09 23:15 | 3.3K | |
| Evaluation-Supervisi..> | 2001-09-09 23:15 | 5.4K | |
| Evaluation-Supervisi..> | 2001-09-09 23:15 | 2.4K | |
| Evaluation-Supervisi..> | 2001-09-09 23:15 | 6.2K | |
| Evaluation-Supervisi..> | 2001-09-09 23:15 | 3.1K | |
| Ergonomics3.htm | 2001-09-09 23:15 | 4.6K | |
| Ergonomics2.htm | 2001-09-09 23:15 | 4.5K | |
| Ergonomics.htm | 2001-09-09 23:15 | 4.5K | |
| Employment Responsib..> | 2001-09-09 23:15 | 2.1K | |
| Employment Reference..> | 2001-09-09 23:15 | 1.5K | |
| Employment Reference..> | 2001-09-09 23:15 | 1.5K | |
| Employment Reference..> | 2001-09-09 23:15 | 1.5K | |
| Employment Reference..> | 2001-09-09 23:15 | 1.5K | |
| Employment Reference..> | 2001-09-09 23:15 | 1.5K | |
| Employment Reference..> | 2001-09-09 23:15 | 1.5K | |
| Employment Of Relati..> | 2001-09-09 23:15 | 1.8K | |
| Employment Of Relati..> | 2001-09-09 23:15 | 1.8K | |
| Employment Of Relati..> | 2001-09-09 23:15 | 1.8K | |
| Employees With Infec..> | 2001-09-09 23:15 | 4.7K | |
| Employees With Infec..> | 2001-09-09 23:15 | 4.7K | |
| Employees With Infec..> | 2001-09-09 23:15 | 4.7K | |
| Employee Use Of Tech..> | 2001-09-09 23:15 | 3.3K | |
| Employee Use Of Tech..> | 2001-09-09 23:15 | 4.5K | |
| Employee Security6.htm | 2001-09-09 23:15 | 8.8K | |
| Employee Security5.htm | 2001-09-09 23:15 | 6.1K | |
| Employee Security4.htm | 2001-09-09 23:15 | 8.8K | |
| Employee Security3.htm | 2001-09-09 23:15 | 6.1K | |
| Employee Security2.htm | 2001-09-09 23:15 | 8.8K | |
| Employee Security.htm | 2001-09-09 23:15 | 6.1K | |
| Employee Safety6.htm | 2001-09-09 23:15 | 8.3K | |
| Employee Safety5.htm | 2001-09-09 23:15 | 4.1K | |
| Employee Safety4.htm | 2001-09-09 23:15 | 8.3K | |
| Employee Safety3.htm | 2001-09-09 23:15 | 4.1K | |
| Employee Safety2.htm | 2001-09-09 23:15 | 8.3K | |
| Employee Safety.htm | 2001-09-09 23:15 | 4.1K | |
| Employee Property Re..> | 2001-09-09 23:14 | 2.3K | |
| Employee Property Re..> | 2001-09-09 23:14 | 2.3K | |
| Employee Property Re..> | 2001-09-09 23:14 | 2.3K | |
| Employee Notificatio..> | 2001-09-09 23:14 | 5.7K | |
| Employee Notificatio..> | 2001-09-09 23:14 | 5.7K | |
| Employee Notificatio..> | 2001-09-09 23:14 | 5.7K | |
| Employee Drug Testin..> | 2001-09-09 23:14 | 2.5K | |
| Employee Drug Testin..> | 2001-09-09 23:14 | 2.5K | |
| Employee Drug Testin..> | 2001-09-09 23:14 | 2.5K | |
| Employee Compensatio..> | 2001-09-09 23:14 | 2.3K | |
| Employee Compensatio..> | 2001-09-09 23:14 | 2.3K | |
| Employee Compensatio..> | 2001-09-09 23:14 | 2.3K | |
| Employee Assistance ..> | 2001-09-09 23:14 | 3.4K | |
| Employee Assistance ..> | 2001-09-09 23:14 | 3.3K | |
| Employee Assistance ..> | 2001-09-09 23:14 | 3.3K | |
| Duties Of Personnel3..> | 2001-09-09 23:14 | 3.6K | |
| Duties Of Personnel2..> | 2001-09-09 23:14 | 3.5K | |
| Duties Of Personnel.htm | 2001-09-09 23:14 | 3.5K | |
| Drug And Alcohol-Fre..> | 2001-09-09 23:14 | 4.5K | |
| Drug And Alcohol-Fre..> | 2001-09-09 23:14 | 5.3K | |
| Dress And Grooming3.htm | 2001-09-09 23:14 | 1.9K | |
| Dress And Grooming.htm | 2001-09-09 23:14 | 2.0K | |
| District Interns2.htm | 2001-09-09 23:14 | 8.7K | |
| District Interns.htm | 2001-09-09 23:14 | 3.8K | |
| Dismissal.htm | 2001-09-09 23:14 | 2.9K | |
| Dismissal-Suspension..> | 2001-09-09 23:14 | 19K | |
| Decision Not To Rehi..> | 2001-09-09 23:14 | 3.1K | |
| Criminal Record Chec..> | 2001-09-09 23:14 | 6.4K | |
| Criminal Record Chec..> | 2001-09-09 23:14 | 7.6K | |
| Criminal Record Chec..> | 2001-09-09 23:14 | 6.4K | |
| Contracts2.htm | 2001-09-09 23:14 | 2.2K | |
| Contracts.htm | 2001-09-09 23:14 | 1.6K | |
| Concerted Action-Wor..> | 2001-09-09 23:14 | 9.1K | |
| Concerted Action-Wor..> | 2001-09-09 23:14 | 4.7K | |
| Concerted Action-Wor..> | 2001-09-09 23:14 | 9.1K | |
| Concerted Action-Wor..> | 2001-09-09 23:14 | 4.7K | |
| Concepts And Roles.htm | 2001-09-09 23:14 | 6.2K | |
| Complaints Concernin..> | 2001-09-09 23:13 | 9.2K | |
| Complaints6.htm | 2001-09-09 23:14 | 5.8K | |
| Complaints5.htm | 2001-09-09 23:13 | 1.7K | |
| Complaints4.htm | 2001-09-09 23:13 | 5.8K | |
| Complaints3.htm | 2001-09-09 23:13 | 1.6K | |
| Complaints2.htm | 2001-09-09 23:13 | 5.8K | |
| Complaints.htm | 2001-09-09 23:13 | 1.6K | |
| Collective Bargainin..> | 2001-09-09 23:13 | 2.5K | |
| Collective Bargainin..> | 2001-09-09 23:13 | 2.5K | |
| Code Of Ethics6.htm | 2001-09-09 23:13 | 3.3K | |
| Code Of Ethics5.htm | 2001-09-09 23:13 | 2.2K | |
| Code Of Ethics4.htm | 2001-09-09 23:13 | 2.8K | |
| Code Of Ethics3.htm | 2001-09-09 23:13 | 2.2K | |
| Code Of Ethics2.htm | 2001-09-09 23:13 | 10K | |
| Code Of Ethics.htm | 2001-09-09 23:13 | 2.2K | |
| Classified Personnel..> | 2001-09-09 23:13 | 2.9K | |
| Classified Personnel..> | 2001-09-09 23:13 | 2.3K | |
| Civil And Legal Righ..> | 2001-09-09 23:13 | 3.8K | |
| Civil And Legal Righ..> | 2001-09-09 23:13 | 3.8K | |
| Civil And Legal Righ..> | 2001-09-09 23:13 | 3.8K | |
| Certification2.htm | 2001-09-09 23:13 | 16K | |
| Certification.htm | 2001-09-09 23:13 | 4.7K | |
| Certificated Personn..> | 2001-09-09 23:13 | 2.2K | |
| Bargaining Units2.htm | 2001-09-09 23:13 | 1.8K | |
| Bargaining Units.htm | 2001-09-09 23:13 | 1.8K | |
| Awards And Recogniti..> | 2001-09-09 23:13 | 2.1K | |
| Awards And Recogniti..> | 2001-09-09 23:13 | 2.1K | |
| Awards And Recogniti..> | 2001-09-09 23:13 | 2.1K | |
| Athletic Team Coache..> | 2001-09-09 23:13 | 7.7K | |
| Athletic Team Coache..> | 2001-09-09 23:13 | 2.8K | |
| Athletic Team Coache..> | 2001-09-09 23:13 | 7.7K | |
| Athletic Team Coache..> | 2001-09-09 23:13 | 2.8K | |
| Athletic Team Coache..> | 2001-09-09 23:13 | 12K | |
| Athletic Team Coache..> | 2001-09-09 23:13 | 7.7K | |
| Athletic Team Coache..> | 2001-09-09 23:13 | 2.8K | |
| Assignment2.htm | 2001-09-09 23:13 | 4.2K | |
| Assignment.htm | 2001-09-09 23:13 | 3.0K | |
| Assignment-Classific..> | 2001-09-09 23:13 | 2.1K | |
| Appointment And Cond..> | 2001-09-09 23:13 | 5.2K | |
| Appointment And Cond..> | 2001-09-09 23:13 | 3.4K | |
| Administrator Traini..> | 2001-09-09 23:12 | 3.4K | |